CAS 1379317-91-5 appears in our catalog under these names: 2-Fluoro-4-methoxy-3-(methylthio)benzoic acid, 95%, 2-Fluoro-4-methoxy-3-(methylthio)benzoic acid. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 5g, 10g, 1g, 250mg, 500mg.
2-fluoro-4-methoxy-3-methylsulfanylbenzoic acid (CAS 1379317-91-5) is a chemical compound with the molecular formula C9H9FO3S and a molecular weight of 216.23 g/mol. IUPAC name: 2-fluoro-4-methoxy-3-methylsulfanylbenzoic acid. InChIKey: DIGSVYOLKMUYDS-UHFFFAOYSA-N.
| Molecular formula | C9H9FO3S |
|---|---|
| Molecular weight | 216.23 g/mol |
| IUPAC name | 2-fluoro-4-methoxy-3-methylsulfanylbenzoic acid |
| InChIKey | DIGSVYOLKMUYDS-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C=C1)C(=O)O)F)SC |
Computed by PubChem (NCBI)