CAS 133748-22-8 is the registry number for 1-(2,4-Dimethylphenyl)-5-oxopyrrolidine-3-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
1-(2,4-dimethylphenyl)-5-oxopyrrolidine-3-carboxylic acid (CAS 133748-22-8) is a chemical compound with the molecular formula C13H15NO3 and a molecular weight of 233.26 g/mol. IUPAC name: 1-(2,4-dimethylphenyl)-5-oxopyrrolidine-3-carboxylic acid. InChIKey: QFVVRJNKLKAZNY-UHFFFAOYSA-N.
| Molecular formula | C13H15NO3 |
|---|---|
| Molecular weight | 233.26 g/mol |
| IUPAC name | 1-(2,4-dimethylphenyl)-5-oxopyrrolidine-3-carboxylic acid |
| InChIKey | QFVVRJNKLKAZNY-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)N2CC(CC2=O)C(=O)O)C |
Computed by PubChem (NCBI)