CAS 1337533-81-9 is the registry number for 1,1-Dimethylethyl 5-bromo-4-chloro-2,3-dihydro-1h-indole-1-carboxylate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
Tert-butyl 5-bromo-4-chloro-2,3-dihydroindole-1-carboxylate (CAS 1337533-81-9) is a chemical compound with the molecular formula C13H15BrClNO2 and a molecular weight of 332.62 g/mol. IUPAC name: tert-butyl 5-bromo-4-chloro-2,3-dihydroindole-1-carboxylate. InChIKey: FTLHKFKCMDCCLY-UHFFFAOYSA-N.
| Molecular formula | C13H15BrClNO2 |
|---|---|
| Molecular weight | 332.62 g/mol |
| IUPAC name | tert-butyl 5-bromo-4-chloro-2,3-dihydroindole-1-carboxylate |
| InChIKey | FTLHKFKCMDCCLY-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2=C1C=CC(=C2Cl)Br |
Computed by PubChem (NCBI)