CAS 921760-46-5 appears in our catalog under these names: 6-Bromospiro[chroman-2,4'-piperidin]-4-one hydrochloride, 95%, 6-Bromospiro(chroman-2,4'-piperidin)-4-one hydrochloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 100mg.
6-bromospiro[3H-chromene-2,4'-piperidine]-4-one;hydrochloride (CAS 921760-46-5) is a chemical compound with the molecular formula C13H15BrClNO2 and a molecular weight of 332.62 g/mol. IUPAC name: 6-bromospiro[3H-chromene-2,4'-piperidine]-4-one;hydrochloride. InChIKey: ITHQWBXTVUNUDX-UHFFFAOYSA-N.
| Molecular formula | C13H15BrClNO2 |
|---|---|
| Molecular weight | 332.62 g/mol |
| IUPAC name | 6-bromospiro[3H-chromene-2,4'-piperidine]-4-one;hydrochloride |
| InChIKey | ITHQWBXTVUNUDX-UHFFFAOYSA-N |
| SMILES | C1CNCCC12CC(=O)C3=C(O2)C=CC(=C3)Br.Cl |
Computed by PubChem (NCBI)