CAS 1337607-03-0 appears in our catalog under these names: 4-Bromo-1-(2-methylphenyl)pyrazole, 98%, 4-Bromo-1-(2-methylphenyl)pyrazole. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 5g, 1g.
4-bromo-1-(2-methylphenyl)pyrazole (CAS 1337607-03-0) is a chemical compound with the molecular formula C10H9BrN2 and a molecular weight of 237.10 g/mol. IUPAC name: 4-bromo-1-(2-methylphenyl)pyrazole. InChIKey: HMULFHZEMGDGLG-UHFFFAOYSA-N.
| Molecular formula | C10H9BrN2 |
|---|---|
| Molecular weight | 237.10 g/mol |
| IUPAC name | 4-bromo-1-(2-methylphenyl)pyrazole |
| InChIKey | HMULFHZEMGDGLG-UHFFFAOYSA-N |
| SMILES | CC1=CC=CC=C1N2C=C(C=N2)Br |
Computed by PubChem (NCBI)