CAS 133766-26-4 appears in our catalog under these names: 2'-O-Allyladenosine, 95%, 2'-O-Allyladenosine. Offered by: Combi-blocks, Biosynth. Available pack sizes: 100mg, 10mg, 5mg, 25mg, 50mg.
(2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-2-(hydroxymethyl)-4-prop-2-enoxyoxolan-3-ol (CAS 133766-26-4) is a chemical compound with the molecular formula C13H17N5O4 and a molecular weight of 307.31 g/mol. IUPAC name: (2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-2-(hydroxymethyl)-4-prop-2-enoxyoxolan-3-ol. InChIKey: DUQRPQVBZQQZPL-QYVSTXNMSA-N.
| Molecular formula | C13H17N5O4 |
|---|---|
| Molecular weight | 307.31 g/mol |
| IUPAC name | (2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-2-(hydroxymethyl)-4-prop-2-enoxyoxolan-3-ol |
| InChIKey | DUQRPQVBZQQZPL-QYVSTXNMSA-N |
| SMILES | C=CCO[C@@H]1[C@@H]([C@H](O[C@H]1N2C=NC3=C(N=CN=C32)N)CO)O |
Computed by PubChem (NCBI)