Products 77378-04-2
CAS 77378-04-2 appears in our catalog under these names: 3'-Deoxy-N6-propionyladenosine, 98%, Cordycepin Impurity 1. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
N-[9-[(2R,3R,5S)-3-hydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl]propanamide (CAS 77378-04-2) is a chemical compound with the molecular formula C13H17N5O4 and a molecular weight of 307.31 g/mol. IUPAC name: N-[9-[(2R,3R,5S)-3-hydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl]propanamide. InChIKey: SPRCIUDOEWOPKD-HHURGBBESA-N.
| Molecular formula | C13H17N5O4 |
|---|---|
| Molecular weight | 307.31 g/mol |
| IUPAC name | N-[9-[(2R,3R,5S)-3-hydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl]propanamide |
| InChIKey | SPRCIUDOEWOPKD-HHURGBBESA-N |
| SMILES | CCC(=O)NC1=C2C(=NC=N1)N(C=N2)[C@H]3[C@@H](C[C@H](O3)CO)O |
Computed by PubChem (NCBI)