Products 1337833-33-6
CAS 1337833-33-6 is the registry number for 7-bromo-4-(trifluoromethyl)indan-1-one, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 500mg, 1g.
7-bromo-4-(trifluoromethyl)-2,3-dihydroinden-1-one (CAS 1337833-33-6) is a chemical compound with the molecular formula C10H6BrF3O and a molecular weight of 279.05 g/mol. IUPAC name: 7-bromo-4-(trifluoromethyl)-2,3-dihydroinden-1-one. InChIKey: YCSXDVVIPPTHBN-UHFFFAOYSA-N.
| Molecular formula | C10H6BrF3O |
|---|---|
| Molecular weight | 279.05 g/mol |
| IUPAC name | 7-bromo-4-(trifluoromethyl)-2,3-dihydroinden-1-one |
| InChIKey | YCSXDVVIPPTHBN-UHFFFAOYSA-N |
| SMILES | C1CC(=O)C2=C(C=CC(=C21)C(F)(F)F)Br |
Computed by PubChem (NCBI)