CAS 1537905-50-2 is the registry number for (E)-4-(2-Bromophenyl)-1,1,1-trifluorobut-3-en-2-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(E)-4-(2-bromophenyl)-1,1,1-trifluorobut-3-en-2-one (CAS 1537905-50-2) is a chemical compound with the molecular formula C10H6BrF3O and a molecular weight of 279.05 g/mol. IUPAC name: (E)-4-(2-bromophenyl)-1,1,1-trifluorobut-3-en-2-one. InChIKey: BQLAZQJCAXHWEG-AATRIKPKSA-N.
| Molecular formula | C10H6BrF3O |
|---|---|
| Molecular weight | 279.05 g/mol |
| IUPAC name | (E)-4-(2-bromophenyl)-1,1,1-trifluorobut-3-en-2-one |
| InChIKey | BQLAZQJCAXHWEG-AATRIKPKSA-N |
| SMILES | C1=CC=C(C(=C1)/C=C/C(=O)C(F)(F)F)Br |
Computed by PubChem (NCBI)