Products 133784-43-7

CAS 133784-43-7 is the registry number for Ropivacaine Impurity 23 HCl. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.

Structural formula: {0} (CAS {1})

N-(2,6-dimethylphenyl)piperidine-4-carboxamide;hydrochloride (CAS 133784-43-7) is a chemical compound with the molecular formula C14H21ClN2O and a molecular weight of 268.78 g/mol. IUPAC name: N-(2,6-dimethylphenyl)piperidine-4-carboxamide;hydrochloride. InChIKey: LEYLHJMNVSLJAM-UHFFFAOYSA-N.

Identity
Molecular formulaC14H21ClN2O
Molecular weight268.78 g/mol
IUPAC nameN-(2,6-dimethylphenyl)piperidine-4-carboxamide;hydrochloride
InChIKeyLEYLHJMNVSLJAM-UHFFFAOYSA-N
SMILESCC1=C(C(=CC=C1)C)NC(=O)C2CCNCC2.Cl

Computed by PubChem (NCBI)