Products 133788-85-9
CAS 133788-85-9 is the registry number for 2-Fluoro-6-hydroxy-3-methylbenzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 1g, 250mg.
2-fluoro-6-hydroxy-3-methylbenzoic acid (CAS 133788-85-9) is a chemical compound with the molecular formula C8H7FO3 and a molecular weight of 170.14 g/mol. IUPAC name: 2-fluoro-6-hydroxy-3-methylbenzoic acid. InChIKey: LTTPWJMIGYEERA-UHFFFAOYSA-N.
| Molecular formula | C8H7FO3 |
|---|---|
| Molecular weight | 170.14 g/mol |
| IUPAC name | 2-fluoro-6-hydroxy-3-methylbenzoic acid |
| InChIKey | LTTPWJMIGYEERA-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C=C1)O)C(=O)O)F |
Computed by PubChem (NCBI)