CAS 32222-48-3 appears in our catalog under these names: (R)-2-Fluoromandelic acid, 98%, (R)-2-(2-Fluorophenyl)-2-hydroxyacetic acid, 98%, (R)-2-(2-Fluorophenyl)-2-hydroxyacetic acid, 98%, 98%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 1g, 100mg, 250mg.
(2R)-2-(2-fluorophenyl)-2-hydroxyacetic acid (CAS 32222-48-3) is a chemical compound with the molecular formula C8H7FO3 and a molecular weight of 170.14 g/mol. IUPAC name: (2R)-2-(2-fluorophenyl)-2-hydroxyacetic acid. InChIKey: WWSRHIZZWWDONI-SSDOTTSWSA-N.
| Molecular formula | C8H7FO3 |
|---|---|
| Molecular weight | 170.14 g/mol |
| IUPAC name | (2R)-2-(2-fluorophenyl)-2-hydroxyacetic acid |
| InChIKey | WWSRHIZZWWDONI-SSDOTTSWSA-N |
| SMILES | C1=CC=C(C(=C1)[C@H](C(=O)O)O)F |
Computed by PubChem (NCBI)