CAS 1337880-37-1 appears in our catalog under these names: 3-Chloroisoquinoline-5-carboxylic acid, 95%, 3-Chloroisoquinoline-5-carboxylic acid, 97%, 97%, 3-CHLOROISOQUINOLINE-5-CARBOXYLIC ACID, 97%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 500mg.
3-chloroisoquinoline-5-carboxylic acid (CAS 1337880-37-1) is a chemical compound with the molecular formula C10H6ClNO2 and a molecular weight of 207.61 g/mol. IUPAC name: 3-chloroisoquinoline-5-carboxylic acid. InChIKey: UCZRSODBXBGUAQ-UHFFFAOYSA-N.
| Molecular formula | C10H6ClNO2 |
|---|---|
| Molecular weight | 207.61 g/mol |
| IUPAC name | 3-chloroisoquinoline-5-carboxylic acid |
| InChIKey | UCZRSODBXBGUAQ-UHFFFAOYSA-N |
| SMILES | C1=CC2=CN=C(C=C2C(=C1)C(=O)O)Cl |
Computed by PubChem (NCBI)