Products 1337952-53-0
CAS 1337952-53-0 is the registry number for Indole-13C8,15N. Offered by: MedChemExpress. Available pack sizes: Get quote.
1H-indole (CAS 1337952-53-0) is a chemical compound with the molecular formula C8H7N and a molecular weight of 126.083 g/mol. IUPAC name: 1H-indole. InChIKey: SIKJAQJRHWYJAI-RIQGLZQJSA-N.
| Molecular formula | C8H7N |
|---|---|
| Molecular weight | 126.083 g/mol |
| IUPAC name | 1H-indole |
| InChIKey | SIKJAQJRHWYJAI-RIQGLZQJSA-N |
| SMILES | [13CH]1=[13CH][13CH]=[13C]2[13C](=[13CH]1)[13CH]=[13CH][15NH]2 |
Computed by PubChem (NCBI)
Synonyms:
Indole-13C8,15N, 1H-Indole-13C8-15N