CAS 73509-21-4 appears in our catalog under these names: Indole-2,4,5,6,7-d5, 1H-Indole-d5. Offered by: TRC, MedChemExpress. Available pack sizes: 100mg, 250mg, 50mg, 10 mg, 5 mg, 1 mg.
2,4,5,6,7-pentadeuterio-1H-indole (CAS 73509-21-4) is a chemical compound with the molecular formula C8H7N and a molecular weight of 122.18 g/mol. IUPAC name: 2,4,5,6,7-pentadeuterio-1H-indole. InChIKey: SIKJAQJRHWYJAI-SNOLXCFTSA-N.
| Molecular formula | C8H7N |
|---|---|
| Molecular weight | 122.18 g/mol |
| IUPAC name | 2,4,5,6,7-pentadeuterio-1H-indole |
| InChIKey | SIKJAQJRHWYJAI-SNOLXCFTSA-N |
| SMILES | [2H]C1=CC2=C(C(=C(C(=C2N1)[2H])[2H])[2H])[2H] |
Computed by PubChem (NCBI)