Products 1338540-55-8
CAS 1338540-55-8 appears in our catalog under these names: OTS514, PBK-IN-9, 98.45%. Offered by: Biosynth, MedChemExpress. Available pack sizes: 25mg, 10mg, 50mg, 10 mg, 25 mg, 50 mg, 5 mg.
9-[4-[(2R)-1-aminopropan-2-yl]phenyl]-8-hydroxy-5H-thieno[2,3-c]quinolin-4-one (CAS 1338540-55-8) is a chemical compound with the molecular formula C20H18N2O2S and a molecular weight of 350.4 g/mol. IUPAC name: 9-[4-[(2R)-1-aminopropan-2-yl]phenyl]-8-hydroxy-5H-thieno[2,3-c]quinolin-4-one. InChIKey: GBOYXCBUDIJBBZ-NSHDSACASA-N.
| Molecular formula | C20H18N2O2S |
|---|---|
| Molecular weight | 350.4 g/mol |
| IUPAC name | 9-[4-[(2R)-1-aminopropan-2-yl]phenyl]-8-hydroxy-5H-thieno[2,3-c]quinolin-4-one |
| InChIKey | GBOYXCBUDIJBBZ-NSHDSACASA-N |
| SMILES | C[C@@H](CN)C1=CC=C(C=C1)C2=C(C=CC3=C2C4=C(C(=O)N3)SC=C4)O |
Computed by PubChem (NCBI)