CAS 372109-24-5 is the registry number for (2-Indol-3-ylethyl)(2-naphthylsulfonyl)amine. Offered by: Biosynth. Available pack sizes: 250mg, 500mg, 1000mg, 5000mg, 2000mg.
N-[2-(1H-indol-3-yl)ethyl]naphthalene-2-sulfonamide (CAS 372109-24-5) is a chemical compound with the molecular formula C20H18N2O2S and a molecular weight of 350.4 g/mol. IUPAC name: N-[2-(1H-indol-3-yl)ethyl]naphthalene-2-sulfonamide. InChIKey: FXOUQLFJHLPUQI-UHFFFAOYSA-N.
| Molecular formula | C20H18N2O2S |
|---|---|
| Molecular weight | 350.4 g/mol |
| IUPAC name | N-[2-(1H-indol-3-yl)ethyl]naphthalene-2-sulfonamide |
| InChIKey | FXOUQLFJHLPUQI-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C=C(C=CC2=C1)S(=O)(=O)NCCC3=CNC4=CC=CC=C43 |
Computed by PubChem (NCBI)