Products 197227-95-5
CAS 197227-95-5 appears in our catalog under these names: Guanosine-13C,15N2 Hydrate, >95% (HPLC), Guanosine-13C-15N2 hydrate, Guanosine-13C,15N2. Offered by: TRC, Chemat Brand, MedChemExpress. Available pack sizes: 10mg, 1mg, on request, 1 mg.
2-(15N)azanyl-9-[(2R,4R,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one (CAS 197227-95-5) is a chemical compound with the molecular formula C10H13N5O5 and a molecular weight of 286.22 g/mol. IUPAC name: 2-(15N)azanyl-9-[(2R,4R,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one. InChIKey: NYHBQMYGNKIUIF-YLZKFVMUSA-N.
| Molecular formula | C10H13N5O5 |
|---|---|
| Molecular weight | 286.22 g/mol |
| IUPAC name | 2-(15N)azanyl-9-[(2R,4R,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one |
| InChIKey | NYHBQMYGNKIUIF-YLZKFVMUSA-N |
| SMILES | C1=NC2=C(N1[C@H]3C([C@H]([C@H](O3)CO)O)O)N=[13C]([15NH]C2=O)[15NH2] |
Computed by PubChem (NCBI)