Products 133891-61-9
CAS 133891-61-9 is the registry number for 1-Benzhydryl-n,n,3-trimethylazetidin-3-amine, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
1-benzhydryl-N,N,3-trimethylazetidin-3-amine (CAS 133891-61-9) is a chemical compound with the molecular formula C19H24N2 and a molecular weight of 280.4 g/mol. IUPAC name: 1-benzhydryl-N,N,3-trimethylazetidin-3-amine. InChIKey: AFRBNSRPSRYNFW-UHFFFAOYSA-N.
| Molecular formula | C19H24N2 |
|---|---|
| Molecular weight | 280.4 g/mol |
| IUPAC name | 1-benzhydryl-N,N,3-trimethylazetidin-3-amine |
| InChIKey | AFRBNSRPSRYNFW-UHFFFAOYSA-N |
| SMILES | CC1(CN(C1)C(C2=CC=CC=C2)C3=CC=CC=C3)N(C)C |
Computed by PubChem (NCBI)