CAS 850036-74-7 is the registry number for (2R,5R)-1,5-Dibenzyl-2-methylpiperazine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2R,5R)-1,5-dibenzyl-2-methylpiperazine (CAS 850036-74-7) is a chemical compound with the molecular formula C19H24N2 and a molecular weight of 280.4 g/mol. IUPAC name: (2R,5R)-1,5-dibenzyl-2-methylpiperazine. InChIKey: RGENJEAVFLOLIB-VQIMIIECSA-N.
| Molecular formula | C19H24N2 |
|---|---|
| Molecular weight | 280.4 g/mol |
| IUPAC name | (2R,5R)-1,5-dibenzyl-2-methylpiperazine |
| InChIKey | RGENJEAVFLOLIB-VQIMIIECSA-N |
| SMILES | C[C@@H]1CN[C@@H](CN1CC2=CC=CC=C2)CC3=CC=CC=C3 |
Computed by PubChem (NCBI)