CAS 1339020-09-5 appears in our catalog under these names: 5-Fluoro-2-(1,2-oxazol-3-yl)-1H-1,3-benzodiazole, 95%, 5-Fluoro-2-(1,2-oxazol-3-yl)-1H-1,3-benzodiazole. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
3-(6-fluoro-1H-benzimidazol-2-yl)-1,2-oxazole (CAS 1339020-09-5) is a chemical compound with the molecular formula C10H6FN3O and a molecular weight of 203.17 g/mol. IUPAC name: 3-(6-fluoro-1H-benzimidazol-2-yl)-1,2-oxazole. InChIKey: IVNLEWGHTODPEL-UHFFFAOYSA-N.
| Molecular formula | C10H6FN3O |
|---|---|
| Molecular weight | 203.17 g/mol |
| IUPAC name | 3-(6-fluoro-1H-benzimidazol-2-yl)-1,2-oxazole |
| InChIKey | IVNLEWGHTODPEL-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1F)NC(=N2)C3=NOC=C3 |
Computed by PubChem (NCBI)