CAS 331443-90-4 is the registry number for 8-Fluoro-3,5-dihydro-4h-pyrimido[5,4-b]indol-4-one, 90%. Offered by: Combi-blocks. Available pack sizes: 100mg.
8-fluoro-3,5-dihydropyrimido[5,4-b]indol-4-one (CAS 331443-90-4) is a chemical compound with the molecular formula C10H6FN3O and a molecular weight of 203.17 g/mol. IUPAC name: 8-fluoro-3,5-dihydropyrimido[5,4-b]indol-4-one. InChIKey: OJRIZGSAMDNDAQ-UHFFFAOYSA-N.
| Molecular formula | C10H6FN3O |
|---|---|
| Molecular weight | 203.17 g/mol |
| IUPAC name | 8-fluoro-3,5-dihydropyrimido[5,4-b]indol-4-one |
| InChIKey | OJRIZGSAMDNDAQ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1F)C3=C(N2)C(=O)NC=N3 |
Computed by PubChem (NCBI)