CAS 1339099-96-5 is the registry number for 1-(2,3-Difluorophenyl)cyclopentanol, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 1g.
1-(2,3-difluorophenyl)cyclopentan-1-ol (CAS 1339099-96-5) is a chemical compound with the molecular formula C11H12F2O and a molecular weight of 198.21 g/mol. IUPAC name: 1-(2,3-difluorophenyl)cyclopentan-1-ol. InChIKey: FSHDFFLGYOMEAM-UHFFFAOYSA-N.
| Molecular formula | C11H12F2O |
|---|---|
| Molecular weight | 198.21 g/mol |
| IUPAC name | 1-(2,3-difluorophenyl)cyclopentan-1-ol |
| InChIKey | FSHDFFLGYOMEAM-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)(C2=C(C(=CC=C2)F)F)O |
Computed by PubChem (NCBI)