Products 2918838-86-3
CAS 2918838-86-3 is the registry number for 1-(cyclobutylmethoxy)-3,5-difluorobenzene, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
1-(cyclobutylmethoxy)-3,5-difluorobenzene (CAS 2918838-86-3) is a chemical compound with the molecular formula C11H12F2O and a molecular weight of 198.21 g/mol. IUPAC name: 1-(cyclobutylmethoxy)-3,5-difluorobenzene. InChIKey: MJISHDKDKKEPEA-UHFFFAOYSA-N.
| Molecular formula | C11H12F2O |
|---|---|
| Molecular weight | 198.21 g/mol |
| IUPAC name | 1-(cyclobutylmethoxy)-3,5-difluorobenzene |
| InChIKey | MJISHDKDKKEPEA-UHFFFAOYSA-N |
| SMILES | C1CC(C1)COC2=CC(=CC(=C2)F)F |
Computed by PubChem (NCBI)