Products 1339209-49-2

CAS 1339209-49-2 is the registry number for 2-(4-Fluorobenzyl)-2-methylbutanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-[(4-fluorophenyl)methyl]-2-methylbutanoic acid (CAS 1339209-49-2) is a chemical compound with the molecular formula C12H15FO2 and a molecular weight of 210.24 g/mol. IUPAC name: 2-[(4-fluorophenyl)methyl]-2-methylbutanoic acid. InChIKey: ICGQAVIWYBLVIK-UHFFFAOYSA-N.

Identity
Molecular formulaC12H15FO2
Molecular weight210.24 g/mol
IUPAC name2-[(4-fluorophenyl)methyl]-2-methylbutanoic acid
InChIKeyICGQAVIWYBLVIK-UHFFFAOYSA-N
SMILESCCC(C)(CC1=CC=C(C=C1)F)C(=O)O

Computed by PubChem (NCBI)