CAS 1339210-38-6 is the registry number for 2-(4-Bromophenyl)-4-(chloromethyl)pyrimidine. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
2-(4-bromophenyl)-4-(chloromethyl)pyrimidine (CAS 1339210-38-6) is a chemical compound with the molecular formula C11H8BrClN2 and a molecular weight of 283.55 g/mol. IUPAC name: 2-(4-bromophenyl)-4-(chloromethyl)pyrimidine. InChIKey: NYBBQCXRGIHZPQ-UHFFFAOYSA-N.
| Molecular formula | C11H8BrClN2 |
|---|---|
| Molecular weight | 283.55 g/mol |
| IUPAC name | 2-(4-bromophenyl)-4-(chloromethyl)pyrimidine |
| InChIKey | NYBBQCXRGIHZPQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NC=CC(=N2)CCl)Br |
Computed by PubChem (NCBI)