CAS 97513-47-8 is the registry number for 2-(4-Bromophenyl)-4-chloro-6-methylpyrimidine. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-(4-bromophenyl)-4-chloro-6-methylpyrimidine (CAS 97513-47-8) is a chemical compound with the molecular formula C11H8BrClN2 and a molecular weight of 283.55 g/mol. IUPAC name: 2-(4-bromophenyl)-4-chloro-6-methylpyrimidine. InChIKey: JYINNANZBDTRTB-UHFFFAOYSA-N.
| Molecular formula | C11H8BrClN2 |
|---|---|
| Molecular weight | 283.55 g/mol |
| IUPAC name | 2-(4-bromophenyl)-4-chloro-6-methylpyrimidine |
| InChIKey | JYINNANZBDTRTB-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC(=N1)C2=CC=C(C=C2)Br)Cl |
Computed by PubChem (NCBI)