CAS 1339242-68-0 appears in our catalog under these names: 3-Amino-1-(2,2,2-trifluoroethyl)piperidin-2-one, 98%, 3-Amino-1-(2,2,2-trifluoroethyl)piperidin-2-one. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 5g, 0,5g, 50mg.
3-amino-1-(2,2,2-trifluoroethyl)piperidin-2-one (CAS 1339242-68-0) is a chemical compound with the molecular formula C7H11F3N2O and a molecular weight of 196.17 g/mol. IUPAC name: 3-amino-1-(2,2,2-trifluoroethyl)piperidin-2-one. InChIKey: OVZICQHZJDXMHT-UHFFFAOYSA-N.
| Molecular formula | C7H11F3N2O |
|---|---|
| Molecular weight | 196.17 g/mol |
| IUPAC name | 3-amino-1-(2,2,2-trifluoroethyl)piperidin-2-one |
| InChIKey | OVZICQHZJDXMHT-UHFFFAOYSA-N |
| SMILES | C1CC(C(=O)N(C1)CC(F)(F)F)N |
Computed by PubChem (NCBI)