CAS 2166175-01-3 is the registry number for (S)-1-(3-Aminopiperidin-1-yl)-2,2,2-trifluoroethan-1-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-[(3S)-3-aminopiperidin-1-yl]-2,2,2-trifluoroethanone (CAS 2166175-01-3) is a chemical compound with the molecular formula C7H11F3N2O and a molecular weight of 196.17 g/mol. IUPAC name: 1-[(3S)-3-aminopiperidin-1-yl]-2,2,2-trifluoroethanone. InChIKey: LWYIJZWLFINIRO-YFKPBYRVSA-N.
| Molecular formula | C7H11F3N2O |
|---|---|
| Molecular weight | 196.17 g/mol |
| IUPAC name | 1-[(3S)-3-aminopiperidin-1-yl]-2,2,2-trifluoroethanone |
| InChIKey | LWYIJZWLFINIRO-YFKPBYRVSA-N |
| SMILES | C1C[C@@H](CN(C1)C(=O)C(F)(F)F)N |
Computed by PubChem (NCBI)