Products 1339333-92-4
CAS 1339333-92-4 is the registry number for rac-(3R,4S)-4-(Pyrrolidin-1-yl)oxolan-3-ol. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
(3R,4S)-4-pyrrolidin-1-yloxolan-3-ol (CAS 1339333-92-4) is a chemical compound with the molecular formula C8H15NO2 and a molecular weight of 157.21 g/mol. IUPAC name: (3R,4S)-4-pyrrolidin-1-yloxolan-3-ol. InChIKey: DDNOMPVVYITSSN-YUMQZZPRSA-N.
| Molecular formula | C8H15NO2 |
|---|---|
| Molecular weight | 157.21 g/mol |
| IUPAC name | (3R,4S)-4-pyrrolidin-1-yloxolan-3-ol |
| InChIKey | DDNOMPVVYITSSN-YUMQZZPRSA-N |
| SMILES | C1CCN(C1)[C@H]2COC[C@@H]2O |
Computed by PubChem (NCBI)