CAS 133950-67-1 appears in our catalog under these names: 3-Indoxyl nonanoate, min. 90 %, 1 g, 3-Indoxyl nonanoate, 3-Indoxyl nonanoate, min. 90 %, 5 g, 3-Indoxyl nonanoate, min. 90 %, 10 g. Offered by: Roth, Biosynth. Available pack sizes: 1g, 5g, 10g.
1H-indol-3-yl nonanoate (CAS 133950-67-1) is a chemical compound with the molecular formula C17H23NO2 and a molecular weight of 273.37 g/mol. IUPAC name: 1H-indol-3-yl nonanoate. InChIKey: XQVOENWHIWENFC-UHFFFAOYSA-N.
| Molecular formula | C17H23NO2 |
|---|---|
| Molecular weight | 273.37 g/mol |
| IUPAC name | 1H-indol-3-yl nonanoate |
| InChIKey | XQVOENWHIWENFC-UHFFFAOYSA-N |
| SMILES | CCCCCCCCC(=O)OC1=CNC2=CC=CC=C21 |
Computed by PubChem (NCBI)