CAS 1339611-58-3 is the registry number for N-((5-Bromothiophen-2-yl)methyl)methanesulfonamide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
N-[(5-bromothiophen-2-yl)methyl]methanesulfonamide (CAS 1339611-58-3) is a chemical compound with the molecular formula C6H8BrNO2S2 and a molecular weight of 270.2 g/mol. IUPAC name: N-[(5-bromothiophen-2-yl)methyl]methanesulfonamide. InChIKey: AYDMQXIHPDLPJW-UHFFFAOYSA-N.
| Molecular formula | C6H8BrNO2S2 |
|---|---|
| Molecular weight | 270.2 g/mol |
| IUPAC name | N-[(5-bromothiophen-2-yl)methyl]methanesulfonamide |
| InChIKey | AYDMQXIHPDLPJW-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)NCC1=CC=C(S1)Br |
Computed by PubChem (NCBI)