CAS 937637-07-5 is the registry number for 4-Bromo-2,5-dimethylthiophene-3-sulfonamide. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
4-bromo-2,5-dimethylthiophene-3-sulfonamide (CAS 937637-07-5) is a chemical compound with the molecular formula C6H8BrNO2S2 and a molecular weight of 270.2 g/mol. IUPAC name: 4-bromo-2,5-dimethylthiophene-3-sulfonamide. InChIKey: XLAYXUQFQMMLJY-UHFFFAOYSA-N.
| Molecular formula | C6H8BrNO2S2 |
|---|---|
| Molecular weight | 270.2 g/mol |
| IUPAC name | 4-bromo-2,5-dimethylthiophene-3-sulfonamide |
| InChIKey | XLAYXUQFQMMLJY-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(S1)C)Br)S(=O)(=O)N |
Computed by PubChem (NCBI)