Products 1339687-10-3
CAS 1339687-10-3 is the registry number for (5-bromo-2-fluorophenyl)(furan-2-yl)methanol, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
(5-bromo-2-fluorophenyl)-(furan-2-yl)methanol (CAS 1339687-10-3) is a chemical compound with the molecular formula C11H8BrFO2 and a molecular weight of 271.08 g/mol. IUPAC name: (5-bromo-2-fluorophenyl)-(furan-2-yl)methanol. InChIKey: QDCHCPKKEPQHAX-UHFFFAOYSA-N.
| Molecular formula | C11H8BrFO2 |
|---|---|
| Molecular weight | 271.08 g/mol |
| IUPAC name | (5-bromo-2-fluorophenyl)-(furan-2-yl)methanol |
| InChIKey | QDCHCPKKEPQHAX-UHFFFAOYSA-N |
| SMILES | C1=COC(=C1)C(C2=C(C=CC(=C2)Br)F)O |
Computed by PubChem (NCBI)