CAS 2060049-93-4 is the registry number for 3-Bromo-5-fluoro-1H,1aH,6H,6aH-cyclopropa(a)indene-1-carboxylic acid, 95%. Offered by: AmBeed. Available pack sizes: 1g.
3-bromo-5-fluoro-1,1a,6,6a-tetrahydrocyclopropa[a]indene-1-carboxylic acid (CAS 2060049-93-4) is a chemical compound with the molecular formula C11H8BrFO2 and a molecular weight of 271.08 g/mol. IUPAC name: 3-bromo-5-fluoro-1,1a,6,6a-tetrahydrocyclopropa[a]indene-1-carboxylic acid. InChIKey: NGUALCYGMYMRCT-UHFFFAOYSA-N.
| Molecular formula | C11H8BrFO2 |
|---|---|
| Molecular weight | 271.08 g/mol |
| IUPAC name | 3-bromo-5-fluoro-1,1a,6,6a-tetrahydrocyclopropa[a]indene-1-carboxylic acid |
| InChIKey | NGUALCYGMYMRCT-UHFFFAOYSA-N |
| SMILES | C1C2C(C2C(=O)O)C3=C1C(=CC(=C3)Br)F |
Computed by PubChem (NCBI)