CAS 1339755-76-8 is the registry number for 3-Bromo-1-(3,4-difluorophenyl)piperidin-2-one. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
3-bromo-1-(3,4-difluorophenyl)piperidin-2-one (CAS 1339755-76-8) is a chemical compound with the molecular formula C11H10BrF2NO and a molecular weight of 290.10 g/mol. IUPAC name: 3-bromo-1-(3,4-difluorophenyl)piperidin-2-one. InChIKey: XVSCTBQBDDZROG-UHFFFAOYSA-N.
| Molecular formula | C11H10BrF2NO |
|---|---|
| Molecular weight | 290.10 g/mol |
| IUPAC name | 3-bromo-1-(3,4-difluorophenyl)piperidin-2-one |
| InChIKey | XVSCTBQBDDZROG-UHFFFAOYSA-N |
| SMILES | C1CC(C(=O)N(C1)C2=CC(=C(C=C2)F)F)Br |
Computed by PubChem (NCBI)