CAS 1486392-98-6 is the registry number for 1-(4-Bromo-2,6-difluorophenyl)piperidin-4-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(4-bromo-2,6-difluorophenyl)piperidin-4-one (CAS 1486392-98-6) is a chemical compound with the molecular formula C11H10BrF2NO and a molecular weight of 290.10 g/mol. IUPAC name: 1-(4-bromo-2,6-difluorophenyl)piperidin-4-one. InChIKey: IWWJMSATZCTSDS-UHFFFAOYSA-N.
| Molecular formula | C11H10BrF2NO |
|---|---|
| Molecular weight | 290.10 g/mol |
| IUPAC name | 1-(4-bromo-2,6-difluorophenyl)piperidin-4-one |
| InChIKey | IWWJMSATZCTSDS-UHFFFAOYSA-N |
| SMILES | C1CN(CCC1=O)C2=C(C=C(C=C2F)Br)F |
Computed by PubChem (NCBI)