CAS 133999-05-0 is the registry number for 4,4,7-Trimethyl-1,3-dihydroquinolin-2-one, 97%. Offered by: Combi-blocks. Available pack sizes: 10g, 25g, 5g, 1g.
4,4,7-trimethyl-1,3-dihydroquinolin-2-one (CAS 133999-05-0) is a chemical compound with the molecular formula C12H15NO and a molecular weight of 189.25 g/mol. IUPAC name: 4,4,7-trimethyl-1,3-dihydroquinolin-2-one. InChIKey: MMYQZWWWDAQMDS-UHFFFAOYSA-N.
| Molecular formula | C12H15NO |
|---|---|
| Molecular weight | 189.25 g/mol |
| IUPAC name | 4,4,7-trimethyl-1,3-dihydroquinolin-2-one |
| InChIKey | MMYQZWWWDAQMDS-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)C(CC(=O)N2)(C)C |
Computed by PubChem (NCBI)