Products 1340190-63-7
CAS 1340190-63-7 is the registry number for 1-(3,5-difluorophenoxy)-2-methylpropan-2-ol, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-(3,5-difluorophenoxy)-2-methylpropan-2-ol (CAS 1340190-63-7) is a chemical compound with the molecular formula C10H12F2O2 and a molecular weight of 202.20 g/mol. IUPAC name: 1-(3,5-difluorophenoxy)-2-methylpropan-2-ol. InChIKey: UKRJBYJAUAVFSZ-UHFFFAOYSA-N.
| Molecular formula | C10H12F2O2 |
|---|---|
| Molecular weight | 202.20 g/mol |
| IUPAC name | 1-(3,5-difluorophenoxy)-2-methylpropan-2-ol |
| InChIKey | UKRJBYJAUAVFSZ-UHFFFAOYSA-N |
| SMILES | CC(C)(COC1=CC(=CC(=C1)F)F)O |
Computed by PubChem (NCBI)