CAS 1340267-20-0 is the registry number for 3-Bromo-2-(4-(trifluoromethyl)phenyl)propanenitrile, 95%. Offered by: AmBeed. Available pack sizes: 1g.
3-bromo-2-[4-(trifluoromethyl)phenyl]propanenitrile (CAS 1340267-20-0) is a chemical compound with the molecular formula C10H7BrF3N and a molecular weight of 278.07 g/mol. IUPAC name: 3-bromo-2-[4-(trifluoromethyl)phenyl]propanenitrile. InChIKey: IDJNKEWWKTVWMG-UHFFFAOYSA-N.
| Molecular formula | C10H7BrF3N |
|---|---|
| Molecular weight | 278.07 g/mol |
| IUPAC name | 3-bromo-2-[4-(trifluoromethyl)phenyl]propanenitrile |
| InChIKey | IDJNKEWWKTVWMG-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(CBr)C#N)C(F)(F)F |
Computed by PubChem (NCBI)