Products 1891223-45-2
CAS 1891223-45-2 is the registry number for 2-bromo-3-methyl-6-(trifluoromethyl)-1H-indole, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg.
2-bromo-3-methyl-6-(trifluoromethyl)-1H-indole (CAS 1891223-45-2) is a chemical compound with the molecular formula C10H7BrF3N and a molecular weight of 278.07 g/mol. IUPAC name: 2-bromo-3-methyl-6-(trifluoromethyl)-1H-indole. InChIKey: JVBWAHYLCBVXKC-UHFFFAOYSA-N.
| Molecular formula | C10H7BrF3N |
|---|---|
| Molecular weight | 278.07 g/mol |
| IUPAC name | 2-bromo-3-methyl-6-(trifluoromethyl)-1H-indole |
| InChIKey | JVBWAHYLCBVXKC-UHFFFAOYSA-N |
| SMILES | CC1=C(NC2=C1C=CC(=C2)C(F)(F)F)Br |
Computed by PubChem (NCBI)