Products 1340329-50-1

CAS 1340329-50-1 appears in our catalog under these names: 3-Azaspiro(5.5)undecane-3-sulfonyl chloride, 95%, 3-Azaspiro(5.5)undecane-3-sulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.

3-azaspiro[5.5]undecane-3-sulfonyl chloride (CAS 1340329-50-1) is a chemical compound with the molecular formula C10H18ClNO2S and a molecular weight of 251.77 g/mol. IUPAC name: 3-azaspiro[5.5]undecane-3-sulfonyl chloride. InChIKey: KCQLXZYZRXYJQG-UHFFFAOYSA-N.

Identity
Molecular formulaC10H18ClNO2S
Molecular weight251.77 g/mol
IUPAC name3-azaspiro[5.5]undecane-3-sulfonyl chloride
InChIKeyKCQLXZYZRXYJQG-UHFFFAOYSA-N
SMILESC1CCC2(CC1)CCN(CC2)S(=O)(=O)Cl

Computed by PubChem (NCBI)