CAS 2138104-34-2 is the registry number for Tetrahydro-1H,3H-3a,7a-(methanoiminomethano)benzo(c)thiophene 2,2-dioxide hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
8lambda6-thia-11-azatricyclo[4.3.3.01,6]dodecane 8,8-dioxide;hydrochloride (CAS 2138104-34-2) is a chemical compound with the molecular formula C10H18ClNO2S and a molecular weight of 251.77 g/mol. IUPAC name: 8lambda6-thia-11-azatricyclo[4.3.3.01,6]dodecane 8,8-dioxide;hydrochloride. InChIKey: RRRYRTYOKQUPQI-UHFFFAOYSA-N.
| Molecular formula | C10H18ClNO2S |
|---|---|
| Molecular weight | 251.77 g/mol |
| IUPAC name | 8lambda6-thia-11-azatricyclo[4.3.3.01,6]dodecane 8,8-dioxide;hydrochloride |
| InChIKey | RRRYRTYOKQUPQI-UHFFFAOYSA-N |
| SMILES | C1CCC23CNCC2(C1)CS(=O)(=O)C3.Cl |
Computed by PubChem (NCBI)