Products 1340355-42-1
CAS 1340355-42-1 is the registry number for 2,2-dimethyl-1-(6-methylpyridin-3-yl)propan-1-ol, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2,2-dimethyl-1-(6-methyl-3-pyridinyl)propan-1-ol (CAS 1340355-42-1) is a chemical compound with the molecular formula C11H17NO and a molecular weight of 179.26 g/mol. IUPAC name: 2,2-dimethyl-1-(6-methyl-3-pyridinyl)propan-1-ol. InChIKey: MPJBPZHVHJEVME-UHFFFAOYSA-N.
| Molecular formula | C11H17NO |
|---|---|
| Molecular weight | 179.26 g/mol |
| IUPAC name | 2,2-dimethyl-1-(6-methyl-3-pyridinyl)propan-1-ol |
| InChIKey | MPJBPZHVHJEVME-UHFFFAOYSA-N |
| SMILES | CC1=NC=C(C=C1)C(C(C)(C)C)O |
Computed by PubChem (NCBI)