CAS 1340366-62-2 appears in our catalog under these names: 4-Bromo-2-(propan-2-ylsulfanyl)benzaldehyde, 4-Bromo-2-(propan-2-ylsulfanyl)benzaldehyde, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 1g, 100mg, 5g.
4-bromo-2-propan-2-ylsulfanylbenzaldehyde (CAS 1340366-62-2) is a chemical compound with the molecular formula C10H11BrOS and a molecular weight of 259.16 g/mol. IUPAC name: 4-bromo-2-propan-2-ylsulfanylbenzaldehyde. InChIKey: SOSXCMCHPMPLCX-UHFFFAOYSA-N.
| Molecular formula | C10H11BrOS |
|---|---|
| Molecular weight | 259.16 g/mol |
| IUPAC name | 4-bromo-2-propan-2-ylsulfanylbenzaldehyde |
| InChIKey | SOSXCMCHPMPLCX-UHFFFAOYSA-N |
| SMILES | CC(C)SC1=C(C=CC(=C1)Br)C=O |
Computed by PubChem (NCBI)