CAS 1800550-07-5 is the registry number for 2-Bromo-6,6-dimethyl-5,6-dihydrobenzo[b]thiophen-7(4H)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-bromo-6,6-dimethyl-4,5-dihydro-1-benzothiophen-7-one (CAS 1800550-07-5) is a chemical compound with the molecular formula C10H11BrOS and a molecular weight of 259.16 g/mol. IUPAC name: 2-bromo-6,6-dimethyl-4,5-dihydro-1-benzothiophen-7-one. InChIKey: BEDPUFOBFVFQKU-UHFFFAOYSA-N.
| Molecular formula | C10H11BrOS |
|---|---|
| Molecular weight | 259.16 g/mol |
| IUPAC name | 2-bromo-6,6-dimethyl-4,5-dihydro-1-benzothiophen-7-one |
| InChIKey | BEDPUFOBFVFQKU-UHFFFAOYSA-N |
| SMILES | CC1(CCC2=C(C1=O)SC(=C2)Br)C |
Computed by PubChem (NCBI)