CAS 1340463-49-1 appears in our catalog under these names: 2-(1H-1,2,4-Triazol-1-yl)phenol, 2-(1H-1,2,4-Triazol-1-yl)phenol, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 0,5g, 50mg, 1g.
2-(1,2,4-triazol-1-yl)phenol (CAS 1340463-49-1) is a chemical compound with the molecular formula C8H7N3O and a molecular weight of 161.16 g/mol. IUPAC name: 2-(1,2,4-triazol-1-yl)phenol. InChIKey: LBVKVHPNSXYVJM-UHFFFAOYSA-N.
| Molecular formula | C8H7N3O |
|---|---|
| Molecular weight | 161.16 g/mol |
| IUPAC name | 2-(1,2,4-triazol-1-yl)phenol |
| InChIKey | LBVKVHPNSXYVJM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)N2C=NC=N2)O |
Computed by PubChem (NCBI)