Products 1340485-29-1
CAS 1340485-29-1 is the registry number for 4-Amino-N,N,5-trimethyl-1H-pyrazole-3-carboxamide. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
4-amino-N,N,5-trimethyl-1H-pyrazole-3-carboxamide (CAS 1340485-29-1) is a chemical compound with the molecular formula C7H12N4O and a molecular weight of 168.20 g/mol. IUPAC name: 4-amino-N,N,5-trimethyl-1H-pyrazole-3-carboxamide. InChIKey: BSEXOWLJEXKYMT-UHFFFAOYSA-N.
| Molecular formula | C7H12N4O |
|---|---|
| Molecular weight | 168.20 g/mol |
| IUPAC name | 4-amino-N,N,5-trimethyl-1H-pyrazole-3-carboxamide |
| InChIKey | BSEXOWLJEXKYMT-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NN1)C(=O)N(C)C)N |
Computed by PubChem (NCBI)