Products 1340583-40-5

CAS 1340583-40-5 is the registry number for 5-Amino-2-chloro-thiazole-4-carboxylic Acid Ethyl Ester. Offered by: TRC. Available pack sizes: 250mg.

Structural formula: {0} (CAS {1})

Ethyl 5-amino-2-chloro-1,3-thiazole-4-carboxylate (CAS 1340583-40-5) is a chemical compound with the molecular formula C6H7ClN2O2S and a molecular weight of 206.65 g/mol. IUPAC name: ethyl 5-amino-2-chloro-1,3-thiazole-4-carboxylate. InChIKey: FNKGRDMWAZPEMI-UHFFFAOYSA-N.

Identity
Molecular formulaC6H7ClN2O2S
Molecular weight206.65 g/mol
IUPAC nameethyl 5-amino-2-chloro-1,3-thiazole-4-carboxylate
InChIKeyFNKGRDMWAZPEMI-UHFFFAOYSA-N
SMILESCCOC(=O)C1=C(SC(=N1)Cl)N

Computed by PubChem (NCBI)