CAS 1340599-91-8 appears in our catalog under these names: (7-Methyl-1-benzothiophen-2-yl)boronic acid, B-(7-Methylbenzo[b]thien-2-yl)boronic acid, 95%, 95%, (7-Methyl-1-benzothiophen-2-yl)boronic acid, 95%. Offered by: Biosynth, Chemat, Fluorochem. Available pack sizes: 0,5g, 50mg, 100mg, 250mg.
(7-methyl-1-benzothiophen-2-yl)boronic acid (CAS 1340599-91-8) is a chemical compound with the molecular formula C9H9BO2S and a molecular weight of 192.05 g/mol. IUPAC name: (7-methyl-1-benzothiophen-2-yl)boronic acid. InChIKey: VVGBIBABFLRFRZ-UHFFFAOYSA-N.
| Molecular formula | C9H9BO2S |
|---|---|
| Molecular weight | 192.05 g/mol |
| IUPAC name | (7-methyl-1-benzothiophen-2-yl)boronic acid |
| InChIKey | VVGBIBABFLRFRZ-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=CC=CC(=C2S1)C)(O)O |
Computed by PubChem (NCBI)